•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cyclobutanes

Set Ascending Direction

   

Items 51 to 60 of 192 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. 3-aminocyclobutane-1-carboxylic acid hydrochloride

    CAS No.: 1201190-01-3
    Catalog No.: 171477
    Purity: 95%
    MF: C5H10ClNO2
    MW: 151.593
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC1CC(C1)C(O)=O
  2. 3-(chloromethyl)-1,1-difluorocyclobutane

    CAS No.: 1290625-58-9
    Catalog No.: 195553
    Purity: 95%
    MF: C5H7ClF2
    MW: 140.56
    Storage: 2-8 degree Celsius
    SMILES: ClCC1CC(C1)(F)F
  3. ethyl 3-bromocyclobutane-1-carboxylate

    CAS No.: 1934754-13-8
    Catalog No.: 195554
    Purity: 95%
    MF: C7H11BrO2
    MW: 207.067
    Storage: 2-8 degree Celsius
    SMILES: BrC1CC(C1)C(=O)OCC
  4. 3-(methoxymethyl)cyclobutan-1-amine

    CAS No.: 1209654-41-0
    Catalog No.: 195555
    Purity: 95%
    MF: C6H13NO
    MW: 115.176
    Storage: 2-8 degree Celsius
    SMILES: COCC1CC(C1)N
  5. 3-(benzyloxy)-2,2-dimethylcyclobutan-1-one

    CAS No.: 2063-92-5
    Catalog No.: 195556
    Purity: 95%
    MF: C13H16O2
    MW: 204.269
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC1C(C(C1)=O)(C)C
  6. 1-(3-hydroxypropyl)cyclobutan-1-ol

    CAS No.: 1584139-24-1
    Catalog No.: 195557
    Purity: 95%
    MF: C7H14O2
    MW: 130.187
    Storage: 2-8 degree Celsius
    SMILES: OCCCC1(CCC1)O
  7. 3-(benzyloxy)-2,2-dimethylcyclobutan-1-ol

    CAS No.: 17139-85-4
    Catalog No.: 195558
    Purity: 95%
    MF: C13H18O2
    MW: 206.285
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC1C(C(C1)O)(C)C
  8. 2,2-dimethylcyclobutan-1-ol

    CAS No.: 35301-44-1
    Catalog No.: 195559
    Purity: 95%
    MF: C6H12O
    MW: 100.161
    Storage: 2-8 degree Celsius
    SMILES: CC1(C(CC1)O)C
  9. 3-tert-butylcyclobutanone

    CAS No.: 20614-90-8
    Catalog No.: 195560
    Purity: 95%
    MF: C8H14O
    MW: 126.199
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)C1CC(C1)=O
  10. (1S,2S)-2-aminocyclobutan-1-ol hydrochloride

    CAS No.: 1820572-14-2
    Catalog No.: 195561
    Purity: 95%
    MF: C4H10ClNO
    MW: 123.583
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@@H]1[C@H](CC1)O
Loading ...Load More ...
Set Ascending Direction

   

Items 51 to 60 of 192 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8