•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cyclobutanes

Set Descending Direction

   

Items 61 to 70 of 192 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. 3-(trifluoromethyl)cyclobutan-1-amine hydrochloride

    CAS No.: 1803601-06-0
    Catalog No.: 195562
    Purity: 95%
    MF: C5H9ClF3N
    MW: 175.581
    Storage: 2-8 degree Celsius
    SMILES: Cl.FC(C1CC(C1)N)(F)F
  2. trans-3-[(tert-butoxycarbonylamino)methyl]cyclobutanecarboxylicacid

    CAS No.: 1638772-03-8
    Catalog No.: 195563
    Purity: 95%
    MF: C11H19NO4
    MW: 229.276
    Storage: 2-8 degree Celsius
    SMILES: O=C([C@H]1C[C@H](CNC(OC(C)(C)C)=O)C1)O
  3. 3-amino-3-methylcyclobutan-1-one hydrochloride

    CAS No.: 2089255-22-9
    Catalog No.: 195564
    Purity: 95%
    MF: C5H10ClNO
    MW: 135.594
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC1(CC(C1)=O)C
  4. cyclobutane-1,2-dicarboxylic acid

    CAS No.: 3396-14-3
    Catalog No.: 195565
    Purity: 95%
    MF: C6H8O4
    MW: 144.126
    Storage: 2-8 degree Celsius
    SMILES: C1(C(CC1)C(=O)O)C(=O)O
  5. 1-((tert-butoxycarbonyl)amino)-3-methoxycyclobutane-1-carboxylic acid

    CAS No.: 1700442-25-6
    Catalog No.: 195566
    Purity: 95%
    MF: C11H19NO5
    MW: 245.275
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)NC1(CC(C1)OC)C(=O)O
  6. benzyl trans-3-hydroxycyclobutanecarboxylate

    CAS No.: 128041-58-7
    Catalog No.: 195567
    Purity: 95%
    MF: C12H14O3
    MW: 206.241
    Storage: 2-8 degree Celsius
    SMILES: O[C@@H]1C[C@H](C1)C(=O)OCC1=CC=CC=C1
  7. 3,3-difluorocyclobutane-1-carbaldehyde

    CAS No.: 1246765-49-0
    Catalog No.: 195568
    Purity: 95%
    MF: C5H6F2O
    MW: 120.098
    Storage: 2-8 degree Celsius
    SMILES: FC1(CC(C1)C=O)F
  8. trans-1-amino-3-(hydroxymethyl)cyclobutane-1-carboxylic acid

    CAS No.: 116823-32-6
    Catalog No.: 195569
    Purity: 95%
    MF: C6H11NO3
    MW: 145.158
    Storage: 2-8 degree Celsius
    SMILES: O=C([C@@]1(N)C[C@H](CO)C1)O
  9. cis-3-[(tert-butoxycarbonylamino)methyl]cyclobutanecarboxylicacid

    CAS No.: 1427319-48-9
    Catalog No.: 195570
    Purity: 95%
    MF: C11H19NO4
    MW: 229.276
    Storage: 2-8 degree Celsius
    SMILES: O=C([C@H]1C[C@@H](CNC(OC(C)(C)C)=O)C1)O
  10. benzyl N-[(3-oxocyclobutyl)methyl]carbamate

    CAS No.: 1869903-79-6
    Catalog No.: 195901
    Purity: 95%
    MF: C13H15NO3
    MW: 233.267
    Storage: 2-8 degree Celsius
    SMILES: O=C1CC(C1)CNC(OCC1=CC=CC=C1)=O
Loading ...Load More ...
Set Descending Direction

   

Items 61 to 70 of 192 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9