•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Triazolopyridines

Set Descending Direction

   

Items 11 to 20 of 71 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. [1,2,4]triazolo[1,5-a]pyridin-2-amine

    CAS No.: 874-46-4
    Catalog No.: 103496
    Purity: 95%
    MF: C6H6N4
    MW: 134.142
    Storage: 2-8 degree Celsius
    SMILES: NC1=NN2C=CC=CC2=N1
  2. 6-iodo[1,2,4]triazolo[1,5-a]pyridine

    CAS No.: 614750-84-4
    Catalog No.: 101169
    Purity: 95%
    MF: C6H4IN3
    MW: 245.023
    Storage: 2-8 degree Celsius
    SMILES: IC1=CN2N=CN=C2C=C1
  3. 8-bromo-6-chloro-2-methyl-[1,2,4]triazolo[1,5-a]pyridine

    CAS No.: 1159813-15-6
    Catalog No.: 197680
    Purity: 95%
    MF: C7H5BrClN3
    MW: 246.495
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=2N(C=C(C1)Cl)N=C(N2)C
  4. 5-bromo-2-methyl-[1,2,4]triazolo[1,5-a]pyridine

    CAS No.: 1159813-10-1
    Catalog No.: 197679
    Purity: 95%
    MF: C7H6BrN3
    MW: 212.05
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=CC=2N1N=C(N2)C
  5. 6-bromo-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine

    CAS No.: 1159812-99-3
    Catalog No.: 197678
    Purity: 95%
    MF: C7H3BrF3N3
    MW: 266.02
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=CC=2N(C1)N=C(N2)C(F)(F)F
  6. 6-nitro-[1,2,4]triazolo[1,5-a]pyridin-2-amine

    CAS No.: 31040-15-0
    Catalog No.: 196117
    Purity: 95%
    MF: C6H5N5O2
    MW: 179.139
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C=1C=CC=2N(C1)N=C(N2)N
  7. 6-bromo[1,2,4]triazolo[4,3-a]pyridine

    CAS No.: 108281-79-4
    Catalog No.: 196116
    Purity: 95%
    MF: C6H4BrN3
    MW: 198.023
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=CC=2N(C1)C=NN2
  8. tert-butyl 5-chloro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylate

    CAS No.: 1246759-50-1
    Catalog No.: 195462
    Purity: 95%
    MF: C11H12ClN3O2
    MW: 253.689
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC(=CC=2N1C=NN2)C(=O)OC(C)(C)C
  9. [1,2,4]triazolo[1,5-a]pyridin-7-ol

    CAS No.: 1033810-70-6
    Catalog No.: 131923
    Purity: 95%
    MF: C6H5N3O
    MW: 135.126
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC2=NC=NN2C=C1
  10. 6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one

    CAS No.: 425702-91-6
    Catalog No.: ZB2274
    Purity: 95%
    MF: C6H4BrN3O
    MW: 214.022
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=CC=2N(C1)C(NN2)=O
Loading ...Load More ...
Set Descending Direction

   

Items 11 to 20 of 71 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5