•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrimidines

Set Ascending Direction

   

Items 1 to 10 of 1117 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 5-bromo-6-(trifluoromethyl)pyrimidin-4(3H)-one

    CAS No.: 126538-81-6
    Catalog No.: 192959
    Purity: 95%
    MF: C5H2BrF3N2O
    MW: 242.982
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(NC=NC1C(F)(F)F)=O
  2. 5-bromo-2-methyl-4-(trifluoromethyl)pyrimidine

    CAS No.: 1781830-29-2
    Catalog No.: 192960
    Purity: 95%
    MF: C6H4BrF3N2
    MW: 241.01
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=NC(=NC1)C)C(F)(F)F
  3. methyl 4-(trifluoromethyl)pyrimidine-5-carboxylate

    CAS No.: 1803738-77-3
    Catalog No.: 192961
    Purity: 95%
    MF: C7H5F3N2O2
    MW: 206.123
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=NC=NC=C1C(=O)OC)(F)F
  4. N-methyl-1-(pyrimidin-2-yl)methanamine hydrochloride

    CAS No.: 1956365-37-9
    Catalog No.: 192963
    Purity: 95%
    MF: C6H10ClN3
    MW: 159.62
    Storage: 2-8 degree Celsius
    SMILES: Cl.CNCC1=NC=CC=N1
  5. 5-(2-hydroxyethyl)-6-methyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one

    CAS No.: 21585-16-0
    Catalog No.: 192964
    Purity: 95%
    MF: C7H10N2O2S
    MW: 186.236
    Storage: 2-8 degree Celsius
    SMILES: OCCC=1C(NC(NC1C)=S)=O
  6. ethyl 2,4-dimethylpyrimidine-5-carboxylate

    CAS No.: 2226-86-0
    Catalog No.: 192965
    Purity: 95%
    MF: C9H12N2O2
    MW: 180.207
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC=C(C(=N1)C)C(=O)OCC
  7. 4-(trifluoromethyl)pyrimidine-5-carboxamide

    CAS No.: 2639626-83-6
    Catalog No.: 192966
    Purity: 95%
    MF: C6H4F3N3O
    MW: 191.112
    Storage: 2-8 degree Celsius
    SMILES: FC(C1=NC=NC=C1C(=O)N)(F)F
  8. 2-amino-4-oxo-1,4-dihydropyrimidine-5-carbonitrile

    CAS No.: 27058-50-0
    Catalog No.: 192967
    Purity: 95%
    MF: C5H4N4O
    MW: 136.114
    Storage: 2-8 degree Celsius
    SMILES: NC=1NC=C(C(N1)=O)C#N
  9. 2-amino-4-hydroxypyrimidine-5-carboxylic acid

    CAS No.: 40769-70-8
    Catalog No.: 192968
    Purity: 95%
    MF: C5H5N3O3
    MW: 155.113
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(C(=N1)O)C(=O)O
  10. 5-bromo-4-chloro-6-(trifluoromethyl)pyrimidine

    CAS No.: 425392-76-3
    Catalog No.: 192969
    Purity: 95%
    MF: C5HBrClF3N2
    MW: 261.428
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=NC=NC1C(F)(F)F)Cl
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 1117 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5