•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Quinoxalines

Set Descending Direction

   

Items 51 to 60 of 73 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. 3,4-dihydroquinoxalin-2(1H)-one

    CAS No.: 59564-59-9
    Catalog No.: 105787
    Purity: 95%
    MF: C8H8N2O
    MW: 148.165
    Storage: 2-8 degree Celsius
    SMILES: O=C1CNC2=C(N1)C=CC=C2
  2. 2-methyl-3-oxo-3,4-dihydroquinoxaline-6-carboxylic acid

    CAS No.: 103752-84-7
    Catalog No.: TQR0833
    Purity: 95%
    MF: C10H8N2O3
    MW: 204.185
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC2=CC=C(C=C2NC1=O)C(=O)O
  3. ethyl 3-chloro-2-methylquinoxaline-6-carboxylate

    CAS No.: 1417411-50-7
    Catalog No.: TQR0832
    Purity: 95%
    MF: C12H11ClN2O2
    MW: 250.685
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C(=NC2=CC=C(C=C2N1)C(=O)OCC)C
  4. (R)-(4-cyclopropyl-3,4-dihydroquinoxalin-1(2H)-yl)(thiazolidin-4-yl)methanone

    CAS No.: 1445985-48-7
    Catalog No.: TQR0821
    Purity: 95%
    MF: C15H19N3OS
    MW: 289.404
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)N1CCN(C2=CC=CC=C12)C(=O)[C@H]1NCSC1
  5. 1-cyclopropyl-1,2,3,4-tetrahydroquinoxaline

    CAS No.: 1224640-13-4
    Catalog No.: TQP0771
    Purity: 95%
    MF: C11H14N2
    MW: 174.247
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)N1CCNC2=CC=CC=C12
  6. 2,3-dichloroquinoxaline-6-sulfonyl chloride

    CAS No.: 2149-05-5
    Catalog No.: GS3167
    Purity: 95%
    MF: C8H3Cl3N2O2S
    MW: 297.55
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC2=CC=C(C=C2N=C1Cl)S(=O)(=O)Cl
  7. 6-chloro-2,3-dimethylquinoxaline

    CAS No.: 17911-93-2
    Catalog No.: TQP2608
    Purity: 95%
    MF: C10H9ClN2
    MW: 192.649
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C2N=C(C(=NC2=CC1)C)C
  8. 5,8-dibromo-2,3-diphenylquinoxaline

    CAS No.: 94544-77-1
    Catalog No.: TQP2607
    Purity: 95%
    MF: C20H12Br2N2
    MW: 440.138
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2N=C(C(=NC2=C(C=C1)Br)C1=CC=CC=C1)C1=CC=CC=C1
  9. 6-chloro-2,3-diphenylquinoxaline

    CAS No.: 36305-60-9
    Catalog No.: TQP2606
    Purity: 95%
    MF: C20H13ClN2
    MW: 316.791
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C2N=C(C(=NC2=CC1)C1=CC=CC=C1)C1=CC=CC=C1
  10. 6-bromo-2,3-diphenylquinoxaline

    CAS No.: 216387-73-4
    Catalog No.: TQP2605
    Purity: 95%
    MF: C20H13BrN2
    MW: 361.242
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2N=C(C(=NC2=CC1)C1=CC=CC=C1)C1=CC=CC=C1
Loading ...Load More ...
Set Descending Direction

   

Items 51 to 60 of 73 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8