3-bromo-4-fluoro(trifluoromethoxy)benzene
$200.00
CAS No.: 286932-57-8
Catalog No.: WLZ1701
Purity: 95%
MF: C7H3BrF4O
MW: 258.996
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C=CC1F)OC(F)(F)F
Catalog No.: WLZ1701
Purity: 95%
MF: C7H3BrF4O
MW: 258.996
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C=CC1F)OC(F)(F)F
CAS NO.: 286932-57-8; 3-bromo-4-fluoro(trifluoromethoxy)benzene. PROPERTIES: This halogenated aromatic compound features a bromine atom, a fluorine atom, and a trifluoromethoxy group on a benzene ring, creating a molecule with potential applications in organic synthesis and pharmaceutical research. The 3-bromo-4-fluoro(trifluoromethoxy)benzene typically appears as a colorless to pale yellow liquid with moderate solubility in common organic solvents. Its molecular structure includes electron-withdrawing trifluoromethoxy and fluorine groups and a bromine atom that influence the electronic properties of the aromatic system. For optimal stability and to prevent degradation, this compound should be stored at 2-8 degree Celsius in a tightly sealed container under anhydrous conditions. When handling, appropriate safety measures including nitrile gloves and safety goggles are essential. This compound is sensitive to moisture and may hydrolyze in aqueous environments. In case of accidental spillage, clean the area with a damp cloth and dispose of materials according to local regulations. APPLICATIONS: The 3-bromo-4-fluoro(trifluoromethoxy)benzene serves as a valuable intermediate in the synthesis of highly functionalized aromatic compounds and materials with specific electronic properties. The trifluoromethoxy group provides a handle for further functionalization through nucleophilic substitution reactions. In medicinal chemistry, this compound functions as a building block for developing pharmaceuticals targeting enzyme inhibitors and receptor modulators. The multiple halogen substituents contribute to target binding affinity and selectivity. Additionally, the molecule finds utility in materials science as a monomer for creating polymers with specific electronic and optical properties. Researchers utilizing this compound benefit from its defined substitution pattern, enabling the development of advanced materials with tailored electronic characteristics.
Reviews
Write Your Own Review