2-chloro-4-(trifluoromethoxy)-1-iodobenzene
$300.00
CAS No.: 345226-19-9
Catalog No.: WLZ1641
Purity: 95%
MF: C7H3ClF3IO
MW: 322.451
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=CC(=C1)OC(F)(F)F)I
Catalog No.: WLZ1641
Purity: 95%
MF: C7H3ClF3IO
MW: 322.451
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=CC(=C1)OC(F)(F)F)I
CAS NO.: 345226-19-9; 2-chloro-4-(trifluoromethoxy)-1-iodobenzene. PROPERTIES: This halogenated aromatic compound features a chlorine atom, a trifluoromethoxy group, and an iodine atom on a benzene ring, creating a molecule with potential applications in organic synthesis and pharmaceutical research. The 2-chloro-4-(trifluoromethoxy)-1-iodobenzene typically appears as a white to off-white crystalline solid with moderate solubility in common organic solvents. Its molecular structure includes multiple halogen atoms and a trifluoromethoxy group that influence the electronic properties of the aromatic system. For optimal stability and to prevent degradation, this compound should be stored at 2-8 degree Celsius in a tightly sealed container under anhydrous conditions. When handling, appropriate safety measures including nitrile gloves and safety goggles are essential. This compound is sensitive to moisture and may hydrolyze in aqueous environments. In case of accidental spillage, clean the area with a damp cloth and dispose of materials according to local regulations. APPLICATIONS: The 2-chloro-4-(trifluoromethoxy)-1-iodobenzene serves as a valuable intermediate in the synthesis of highly functionalized aromatic compounds and materials with specific electronic properties. The iodine substituent provides a handle for cross-coupling reactions, enabling the creation of substituted benzene derivatives with diverse biological activities. In medicinal chemistry, this compound functions as a building block for developing pharmaceuticals targeting enzyme inhibitors and receptor modulators. The trifluoromethoxy and chlorine substituents contribute to target binding affinity and selectivity. Additionally, the molecule finds utility in materials science as a monomer for creating polymers with specific electronic and optical properties. Researchers utilizing this compound benefit from its defined substitution pattern, enabling the development of advanced materials with tailored electronic characteristics.
Reviews
Write Your Own Review