•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Indolines

Set Descending Direction

   

Items 21 to 30 of 179 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 1-tert-butyl 6-methyl indoline-1,6-dicarboxylate

    CAS No.: 1220039-51-9
    Catalog No.: 192688
    Purity: 95%
    MF: C15H19NO4
    MW: 277.32
    Storage: 2-8 degree Celsius
    SMILES: N1(CCC2=CC=C(C=C12)C(=O)OC)C(=O)OC(C)(C)C
  2. tert-butyl 6-methoxyindoline-1-carboxylate

    CAS No.: 1394248-15-7
    Catalog No.: 192689
    Purity: 95%
    MF: C14H19NO3
    MW: 249.31
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C2CCN(C2=C1)C(=O)OC(C)(C)C
  3. tert-butyl 5-nitro-2-oxoindoline-1-carboxylate

    CAS No.: 1799838-87-1
    Catalog No.: 192691
    Purity: 95%
    MF: C13H14N2O5
    MW: 278.264
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C=1C=C2CC(N(C2=CC1)C(=O)OC(C)(C)C)=O
  4. 1-tert-butyl 2-methyl indoline-1,2-dicarboxylate

    CAS No.: 186704-03-0
    Catalog No.: 192692
    Purity: 95%
    MF: C15H19NO4
    MW: 277.32
    Storage: 2-8 degree Celsius
    SMILES: N1(C(CC2=CC=CC=C12)C(=O)OC)C(=O)OC(C)(C)C
  5. tert-butyl 2-oxoindoline-1-carboxylate

    CAS No.: 214610-10-3
    Catalog No.: 192693
    Purity: 95%
    MF: C13H15NO3
    MW: 233.267
    Storage: 2-8 degree Celsius
    SMILES: O=C1N(C2=CC=CC=C2C1)C(=O)OC(C)(C)C
  6. 7-nitroindoline hydrochloride

    CAS No.: 2173992-22-6
    Catalog No.: 192694
    Purity: 95%
    MF: C8H9ClN2O2
    MW: 200.625
    Storage: 2-8 degree Celsius
    SMILES: Cl.[N+](=O)([O-])C=1C=CC=C2CCNC12
  7. 3,3-dimethylindolin-4-amine dihydrochloride

    CAS No.: 2411639-80-8
    Catalog No.: 192696
    Purity: 95%
    MF: C10H16Cl2N2
    MW: 235.158
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.CC1(CNC=2C=CC=C(C12)N)C
  8. tert-butyl 2-aminoindoline-1-carboxylate

    CAS No.: 2639625-80-0
    Catalog No.: 192697
    Purity: 95%
    MF: C13H18N2O2
    MW: 234.299
    Storage: 2-8 degree Celsius
    SMILES: NC1N(C2=CC=CC=C2C1)C(=O)OC(C)(C)C
  9. 5-chloro-1-methylindolin-2-one

    CAS No.: 41192-33-0
    Catalog No.: 192698
    Purity: 95%
    MF: C9H8ClNO
    MW: 181.622
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C2CC(N(C2=CC1)C)=O
  10. 5-chloro-1-ethylindolin-2-one

    CAS No.: 41192-34-1
    Catalog No.: 192699
    Purity: 95%
    MF: C10H10ClNO
    MW: 195.649
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C2CC(N(C2=CC1)CC)=O
Loading ...Load More ...
Set Descending Direction

   

Items 21 to 30 of 179 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5