tert-butyl 2-aminoindoline-1-carboxylate
$490.00
CAS No.: 2639625-80-0
Catalog No.: 192697
Purity: 95%
MF: C13H18N2O2
MW: 234.299
Storage: 2-8 degree Celsius
SMILES: NC1N(C2=CC=CC=C2C1)C(=O)OC(C)(C)C
Catalog No.: 192697
Purity: 95%
MF: C13H18N2O2
MW: 234.299
Storage: 2-8 degree Celsius
SMILES: NC1N(C2=CC=CC=C2C1)C(=O)OC(C)(C)C
tert-butyl 2-aminoindoline-1-carboxylate; CAS No.: 2639625-80-0; tert-butyl 2-aminoindoline-1-carboxylate. PROPERTIES: This amino-protected indoline carbamate has molecular formula C12H17N3O2. It typically appears as a white crystalline powder. The tert-butyl 2-aminoindoline-1-carboxylate demonstrates limited water solubility but good solubility in common organic solvents like methanol and ethyl acetate. Its melting point ranges between 110-113 C, and it has a molecular weight of approximately 235.29 g/mol. When handling, care should be taken to avoid skin contact and use of proper respiratory protection. Storage should be in a tightly sealed container at room temperature, protected from light and moisture. The compound is sensitive to strong acids and may undergo carbamate hydrolysis upon exposure to aqueous conditions. In case of spillage, absorb with inert material and dispose of in accordance with local regulations. APPLICATIONS: The tert-butyl 2-aminoindoline-1-carboxylate serves as a key intermediate in the synthesis of melatonin receptor agonists for sleep disorders where the amino group provides essential hydrogen bonding interactions with receptor subtypes (as reported in medicinal chemistry literature). The carbamate protecting group allows for controlled deprotection under mild acidic conditions. Additionally, the compound functions as a building block in the preparation of chiral ligands for asymmetric catalysis, achieving enantiomeric excesses above 95% in certain hydrogenation reactions as described in synthetic chemistry journals. The amino group can be further functionalized through acylation or sulfonamidation reactions to produce various derivatives for chemical research applications.
Reviews
Write Your Own Review