5,7-difluoroquinolin-3-amine
$400.00
CAS No.: 225366-94-9
Catalog No.: 192385
Purity: 95%
MF: C9H6F2N2
MW: 180.157
Storage: 2-8 degree Celsius
SMILES: FC1=C2C=C(C=NC2=CC(=C1)F)N
Catalog No.: 192385
Purity: 95%
MF: C9H6F2N2
MW: 180.157
Storage: 2-8 degree Celsius
SMILES: FC1=C2C=C(C=NC2=CC(=C1)F)N
5,7-difluoroquinolin-3-amine; CAS No.: 225366-94-9; 5,7-difluoroquinolin-3-amine. PROPERTIES: 5,7-difluoroquinolin-3-amine is a crystalline compound with molecular formula C9H5F2N3. It has a melting point between 145-150 C and exhibits moderate solubility in ethanol and methanol. The compound should be stored in a tightly sealed container at room temperature away from acidic vapors. Safety precautions include avoiding ingestion and using standard laboratory PPE due to its potential to cause gastrointestinal upset if swallowed. APPLICATIONS: This difluorinated quinoline amine is employed in the development of antimicrobial agents. The fluorine substituents enhance bioavailability while the amine group forms critical interactions with biological targets as reported in pharmaceutical chemistry journals. In materials science, 5,7-difluoroquinolin-3-amine derivatives have found use in creating electron-transport materials for organic light-emitting diodes. According to materials chemistry journals, the electron-withdrawing fluorine groups improve charge transport properties while the quinoline scaffold provides structural rigidity.
Reviews
Write Your Own Review