3,5-difluoro-2-nitroaniline
$460.00
CAS No.: 361-72-8
Catalog No.: 189257
Purity: 95%
MF: C6H4F2N2O2
MW: 174.106
Storage: 2-8 degree Celsius
SMILES: FC=1C(=C(N)C=C(C1)F)[N+](=O)[O-]
Catalog No.: 189257
Purity: 95%
MF: C6H4F2N2O2
MW: 174.106
Storage: 2-8 degree Celsius
SMILES: FC=1C(=C(N)C=C(C1)F)[N+](=O)[O-]
3,5-difluoro-2-nitroaniline; CAS No.: 361-72-8; 3,5-difluoro-2-nitroaniline exemplifies the fluoronitroaniline category within Chem Shuttle's product offerings. As a chemical online store, Chem Shuttle provides access to aniline derivatives with fluoro and nitro substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its fluoro and nitro groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's custom synthesis services allow for the production of such specialized fluoronitroanilines to exact specifications, supporting the discovery of novel therapeutic agents. The company's expertise in cycle compounds ensures that researchers can obtain high-purity 3,5-difluoro-2-nitroaniline, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review