3-isopropylbenzoic acid
$200.00
CAS No.: 5651-47-8
Catalog No.: 189255
Purity: 95%
MF: C10H12O2
MW: 164.204
Storage: 2-8 degree Celsius
SMILES: C(C)(C)C=1C=C(C(=O)O)C=CC1
Catalog No.: 189255
Purity: 95%
MF: C10H12O2
MW: 164.204
Storage: 2-8 degree Celsius
SMILES: C(C)(C)C=1C=C(C(=O)O)C=CC1
3-isopropylbenzoic acid; CAS No.: 5651-47-8; 3-isopropylbenzoic acid is part of Chem Shuttle's collection of substituted benzoic acids that serve as key intermediates in organic synthesis. As a custom chemical synthesis company, Chem Shuttle specializes in producing benzoic acid derivatives with isopropyl substituents that are crucial for the development of various pharmaceuticals and agrochemicals. This compound, with its isopropyl group, is particularly valuable as a building block for the synthesis of bioactive molecules with specific physicochemical properties. Chem Shuttle's online chemical mall provides researchers with convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that 3-isopropylbenzoic acid is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review