5-bromo-1,2-difluoro-3-nitrobenzene
$300.00
CAS No.: 1261988-16-2
Catalog No.: 189258
Purity: 95%
MF: C6H2BrF2NO2
MW: 237.987
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C(=C(C1)F)F)[N+](=O)[O-]
Catalog No.: 189258
Purity: 95%
MF: C6H2BrF2NO2
MW: 237.987
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C(=C(C1)F)F)[N+](=O)[O-]
5-bromo-1,2-difluoro-3-nitrobenzene; CAS No.: 1261988-16-2; 5-bromo-1,2-difluoro-3-nitrobenzene is one of the many bromofluoronitrobenzenes available through Chem Shuttle's extensive product offerings. As a custom chemical synthesis company, Chem Shuttle specializes in producing aromatic compounds with bromo, fluoro, and nitro substituents that serve as key intermediates in drug development and materials science. This compound, with its bromo, fluoro, and nitro groups, is particularly valuable as a building block for the synthesis of various pharmaceuticals and agrochemicals requiring multiple functional groups. Chem Shuttle's role as a worldwide chemical supplier ensures that researchers and manufacturers can access high-purity forms of 5-bromo-1,2-difluoro-3-nitrobenzene. The company's expertise in process chemistry allows for the efficient production of this bromofluoronitrobenzene, supporting innovation in medicinal chemistry and organic synthesis by providing reliable access to essential chemical components.
Reviews
Write Your Own Review