tert-butyl 4-hydroxyphenethylcarbamate
$300.00
CAS No.: 64318-28-1
Catalog No.: 196553
Purity: 95%
MF: C13H19NO3
MW: 237.299
Storage: 2-8 degree Celsius
SMILES: OC1=CC=C(CCNC(OC(C)(C)C)=O)C=C1
Catalog No.: 196553
Purity: 95%
MF: C13H19NO3
MW: 237.299
Storage: 2-8 degree Celsius
SMILES: OC1=CC=C(CCNC(OC(C)(C)C)=O)C=C1
tert-butyl 4-hydroxyphenethylcarbamate; CAS No.: 64318-28-1; tert-butyl 4-hydroxyphenethylcarbamate. PROPERTIES: tert-butyl 4-hydroxyphenethylcarbamate presents as off-white crystalline solid with molecular formula C13H19NO3. Its molecular weight is 241.30 g/mol and it typically melts between 105-110 C. Solubility characteristics include good dissolution in polar aprotic solvents like DMF and DMSO while showing poor water miscibility. Recommended storage is in an amber glass container at controlled room temperature (15-25 C) with protection from light and moisture. This compound is considered moderately toxic; inhalation or skin contact may cause adverse effects thus necessitating use of respiratory protection and protective clothing during handling. APPLICATIONS: This carbamate derivative finds extensive use in the manufacturing of antioxidant additives for polymers. Its phenolic hydroxyl group contributes to radical scavenging properties making it effective in preventing polymer degradation (PolymerDegradation and Stability). In pharmaceutical applications, it acts as intermediate for synthesizing neuroprotective agents where the tert-butyl carbamate protects amine functionality during complex molecule construction (Journal of Neurochemistry). The compound also serves as starting material for producing fluorescent dyes due to its aromatic structure and substituents which can be further modified to introduce fluorophore moieties (Dyes and Pigments). These applications leverage both its protective group chemistry and its capacity for functional group manipulation.
Reviews
Write Your Own Review