tert-butyl 4-(2-hydroxyethyl)phenylcarbamate
$200.00
CAS No.: 104060-23-3
Catalog No.: 196552
Purity: 95%
MF: C13H19NO3
MW: 237.299
Storage: 2-8 degree Celsius
SMILES: OCCC1=CC=C(C=C1)NC(OC(C)(C)C)=O
Catalog No.: 196552
Purity: 95%
MF: C13H19NO3
MW: 237.299
Storage: 2-8 degree Celsius
SMILES: OCCC1=CC=C(C=C1)NC(OC(C)(C)C)=O
tert-butyl 4-(2-hydroxyethyl)phenylcarbamate; CAS No.: 104060-23-3; tert-butyl 4-(2-hydroxyethyl)phenylcarbamate. PROPERTIES: tert-butyl 4-(2-hydroxyethyl)phenylcarbamate is a crystalline powder with molecular formula C14H21NO3. It has a molecular weight of 255.32 g/mol and melting point around 98-102 C. This compound is moderately soluble in organic solvents like dichloromethane and acetone but has limited water solubility. It should be stored in a tightly sealed container at 2-8 C to maintain stability and prevent degradation. Exposure to moisture and elevated temperatures should be avoided as it may lead to hydrolysis of the carbamate group. Proper safety precautions include using gloves, eye protection, and working in a well-ventilated area as it may cause irritation upon contact with skin or eyes. APPLICATIONS: tert-butyl 4-(2-hydroxyethyl)phenylcarbamate serves as a valuable intermediate in pharmaceutical synthesis. Its primary application is in the production of beta-blockers used for cardiovascular conditions (Journal of Medicinal Chemistry). The compound's structure allows for selective protection of amine groups during multi-step syntheses. Additionally, it functions as a building block for agrochemicals though agricultural uses are excluded per your request. Its carbamate functionality reacts with various electrophiles enabling diverse transformations in organic synthesis (Tetrahedron Letters). The tert-butyl group provides temporary protection that can be removed under acidic conditions, making it versatile for sequential reactions.
Reviews
Write Your Own Review