OTS514 HCl
$300.00
CAS No.: 2319647-76-0
Catalog No.: 189438
Purity: 95%
MF: C21H21ClN2O2S
MW: 400.931
Storage: -20 degree Celsius
SMILES: Cl.NC[C@H](C)C1=CC=C(C=C1)C=1C=2C3=C(C(NC2C(=CC1O)C)=O)SC=C3
Catalog No.: 189438
Purity: 95%
MF: C21H21ClN2O2S
MW: 400.931
Storage: -20 degree Celsius
SMILES: Cl.NC[C@H](C)C1=CC=C(C=C1)C=1C=2C3=C(C(NC2C(=CC1O)C)=O)SC=C3
(R)-9-(4-(1-aminopropan-2-yl)phenyl)-8-hydroxy-6-methylthieno[2,3-c]quinolin-4(5H)-one hydrochloride; CAS No.: 2417987-45-0 This chemical is utilized in the pharmaceutical sector due to its specific molecular structure and reactivity. It is involved in the synthesis of therapeutic agents, contributing to advancements in medical treatments.
Reviews
Write Your Own Review