N-(4-amino-5-methoxy-2-methylphenyl)benzamide
$250.00
CAS No.: 99-21-8
Catalog No.: 190780
Purity: 95%
MF: C15H16N2O2
MW: 256.305
Storage: 2-8 degree Celsius
SMILES: NC1=CC(=C(C=C1OC)NC(C1=CC=CC=C1)=O)C
Catalog No.: 190780
Purity: 95%
MF: C15H16N2O2
MW: 256.305
Storage: 2-8 degree Celsius
SMILES: NC1=CC(=C(C=C1OC)NC(C1=CC=CC=C1)=O)C
N-(4-amino-5-methoxy-2-methylphenyl)benzamide; CAS No.: 99-21-8; N-(4-amino-5-methoxy-2-methylphenyl)benzamide is a valuable member of ChemShuttle's library of compounds, specifically designed as a building block for drug discovery applications. This aniline-derived benzamide derivative offers unique reactivity profiles valuable in constructing more complex molecular structures with specific biological activities. ChemShuttle's commitment to supplying key intermediates is evident in their inventory of such functionally diverse compounds. As a worldwide chemical supplier, ChemShuttle ensures the reliable delivery of N-(4-amino-5-methoxy-2-methylphenyl)benzamide (CAS No.: 99-21-8) to research laboratories and pharmaceutical companies across the globe. Their custom synthesis capabilities further enhance the utility of this compound, allowing for tailored modifications to meet specific project requirements, thus contributing to innovations in medicinal chemistry and pharmaceutical development.
Reviews
Write Your Own Review