3-chloro-2-nitrophenol
$300.00
CAS No.: 17802-02-7
Catalog No.: 190781
Purity: 95%
MF: C6H4ClNO3
MW: 173.555
Storage: 2-8 degree Celsius
SMILES: ClC=1C(=C(C=CC1)O)[N+](=O)[O-]
Catalog No.: 190781
Purity: 95%
MF: C6H4ClNO3
MW: 173.555
Storage: 2-8 degree Celsius
SMILES: ClC=1C(=C(C=CC1)O)[N+](=O)[O-]
3-chloro-2-nitrophenol; CAS No.: 17802-02-7; 3-chloro-2-nitrophenol is part of ChemShuttle's comprehensive library of cycle compounds, serving as a valuable building block in organic synthesis and drug discovery. This chlorinated nitrophenol derivative provides strategic positions for further chemical modification, making it an attractive intermediate for developing novel pharmaceuticals and chemical entities. ChemShuttle's role as a custom chemical synthesis company is highlighted by their ability to produce 3-chloro-2-nitrophenol (CAS No.: 17802-02-7) with consistent quality and reliability. As a leading chemicals distributor, ChemShuttle ensures the availability of this compound to research institutions and industrial laboratories worldwide. Their expertise in blocks chemistry ensures that researchers have access to high-quality intermediates essential for advancing chemical research and development across multiple disciplines.
Reviews
Write Your Own Review