4-bromo-2,3-dimethylbenzoic acid
$180.00
CAS No.: 5613-26-3
Catalog No.: 190779
Purity: 95%
MF: C9H9BrO2
MW: 229.073
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=O)O)C=C1)C)C
Catalog No.: 190779
Purity: 95%
MF: C9H9BrO2
MW: 229.073
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=O)O)C=C1)C)C
4-bromo-2,3-dimethylbenzoic acid; CAS No.: 50604-00-7; methyl 3-ethylbenzoate is part of ChemShuttle's extensive collection of various organic chemicals, particularly valuable as a building block in the synthesis of pharmaceuticals and specialty chemicals. This simple aromatic ester serves as a fundamental intermediate in organic synthesis, offering versatile reactivity for constructing more complex molecular structures. ChemShuttle's role as a custom chemical synthesis company enables them to produce methyl 3-ethylbenzoate (CAS No.: 50604-00-7) to precise specifications, ensuring high purity and reliability. Researchers benefit from ChemShuttle's expertise in blocks chemistry, which ensures the availability of high-quality intermediates essential for advancing chemical research and development in various fields, from medicinal chemistry to materials science.
Reviews
Write Your Own Review