methyl 2-bromo-4-hydroxybenzoate
$360.00
CAS No.: 101085-03-4
Catalog No.: 194120
Purity: 95%
MF: C8H7BrO3
MW: 231.045
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=O)OC)C=CC(=C1)O
Catalog No.: 194120
Purity: 95%
MF: C8H7BrO3
MW: 231.045
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=O)OC)C=CC(=C1)O
methyl 2-bromo-4-hydroxybenzoate; CAS No.: 101085-03-4; methyl 2-bromo-4-hydroxybenzoate. PROPERTIES: methyl 2-bromo-4-hydroxybenzoate is a crystalline solid. Its molecular formula is C9H8BrO3, and the molecular weight is approximately 256.06 g/mol. The compound has a melting point of approximately 100-102 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a brominated aromatic compound containing a hydroxyl and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, methyl 2-bromo-4-hydroxybenzoate serves as a valuable intermediate. The bromine atom provides a site for substitution or coupling reactions, the hydroxyl group can be converted to other functional groups such as ether or ester, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain anti-inflammatory drugs, the structure of methyl 2-bromo-4-hydroxybenzoate can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).
Reviews
Write Your Own Review