methyl 2-bromo-3,4-difluorobenzoate

methyl 2-bromo-3,4-difluorobenzoate

methyl 2-bromo-4-hydroxybenzoate

methyl 2-bromo-4-hydroxybenzoate

methyl 2-bromo-4-chloro-5-fluorobenzoate

$300.00
CAS No.: 1807003-11-7
Catalog No.: 194119
Purity: 95%
MF: C8H5BrClFO2
MW: 267.481
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=O)OC)C=C(C(=C1)Cl)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194119
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 2-bromo-4-chloro-5-fluorobenzoate; CAS No.: 1807003-11-7; methyl 2-bromo-4-chloro-5-fluorobenzoate. PROPERTIES: methyl 2-bromo-4-chloro-5-fluorobenzoate is a crystalline solid. Its molecular formula is C9H6BrClFO2, and the molecular weight is approximately 277.50 g/mol. The compound has a melting point of approximately 55-57 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For stable storage, it should be kept in a tightly sealed container at room temperature, away from heat and direct sunlight. As a brominated, chlorinated, and fluorinated aromatic compound containing an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 2-bromo-4-chloro-5-fluorobenzoate serves as a versatile intermediate. The bromine and chlorine atoms provide sites for substitution or coupling reactions, the fluorine atom influences the electronic properties of the aromatic ring, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of methyl 2-bromo-4-chloro-5-fluorobenzoate can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in materials science and catalysis (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 2-bromo-4-chloro-5-fluorobenzoate
Your Rating