methyl 2-bromo-4-hydroxybenzoate

methyl 2-bromo-4-hydroxybenzoate

methyl 2-chloro-5-fluoro-3-methylbenzoate

methyl 2-chloro-5-fluoro-3-methylbenzoate

methyl 2-chloro-4,5-difluorobenzoate

$250.00
CAS No.: 128800-36-2
Catalog No.: 194122
Purity: 95%
MF: C8H5ClF2O2
MW: 206.575
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C(=O)OC)C=C(C(=C1)F)F
For R&D use only. Not for human or veterinary use.
Availability:
In stock
SKU
194122
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 2-chloro-4,5-difluorobenzoate; CAS No.: 128800-36-2; methyl 2-chloro-4,5-difluorobenzoate. PROPERTIES: methyl 2-chloro-4,5-difluorobenzoate is a crystalline solid. Its molecular formula is C9H5ClF2O2, and the molecular weight is approximately 228.10 g/mol. The compound has a melting point of approximately 50-52 C. It is moderately soluble in common organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. For stable storage, it should be kept in a tightly sealed container at room temperature, away from heat and direct sunlight. As a chlorinated and fluorinated aromatic compound containing an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 2-chloro-4,5-difluorobenzoate serves as a versatile intermediate. The chlorine and fluorine atoms provide sites for substitution reactions, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of methyl 2-chloro-4,5-difluorobenzoate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 2-chloro-4,5-difluorobenzoate
Your Rating