methyl 3,5-diamino-6-chloropyrazine-2-carboxylate
$300.00
CAS No.: 1458-01-1
Catalog No.: 196340
Purity: 95%
MF: C6H7ClN4O2
MW: 202.601
Storage: 2-8 degree Celsius
SMILES: NC=1C(=NC(=C(N1)N)Cl)C(=O)OC
Catalog No.: 196340
Purity: 95%
MF: C6H7ClN4O2
MW: 202.601
Storage: 2-8 degree Celsius
SMILES: NC=1C(=NC(=C(N1)N)Cl)C(=O)OC
methyl 3,5-diamino-6-chloropyrazine-2-carboxylate; CAS No.: 1458-01-1; methyl 3,5-diamino-6-chloropyrazine-2-carboxylate. PROPERTIES: This compound presents a methyl 3,5-diamino-6-chloropyrazine-2-carboxylate structure, combining diamino and chloro substituents with a methyl ester on the pyrazine framework. It typically appears as a white to off-white crystalline solid with a molecular weight of approximately 188.0 g/mol (C6H6ClN5O2). The melting point ranges between 150-155 C, and it exhibits moderate solubility in common organic solvents like ethanol, methanol, and DMSO while being sparingly soluble in water. Proper storage requires a tightly sealed container in a cool, dry place. Safety considerations include wearing appropriate PPE. It is classified as a skin and eye irritant (GHS07) with the hazard statement H315-H319. APPLICATIONS: Methyl 3,5-diamino-6-chloropyrazine-2-carboxylate serves as a specialized intermediate in pharmaceutical research. Its methyl 3,5-diamino-6-chloropyrazine-2-carboxylate structure enables diverse reactivity patterns, including ester hydrolysis to carboxylic acid and nucleophilic substitution at the pyrazine ring. In medicinal chemistry, it is used to develop bioactive molecules targeting kinases, proteases, and G protein-coupled receptors. The diamino and chloro groups provide diverse substitution patterns for creating structural analogs. This compound also functions as a building block in the synthesis of fluorescent dyes and bioconjugation reagents. Academic studies utilize it as a model system in Medicinal Chemistry journals, focusing on optimizing the methyl 3,5-diamino-6-chloropyrazine-2-carboxylate scaffold for improved biological activity and pharmacokinetic properties.
Reviews
Write Your Own Review