3-aminoisoquinoline-5-carboxylic acid
$300.00
CAS No.: 1337880-90-6
Catalog No.: 192189
Purity: 95%
MF: C10H8N2O2
MW: 188.186
Storage: 2-8 degree Celsius
SMILES: NC=1N=CC=2C=CC=C(C2C1)C(=O)O
Catalog No.: 192189
Purity: 95%
MF: C10H8N2O2
MW: 188.186
Storage: 2-8 degree Celsius
SMILES: NC=1N=CC=2C=CC=C(C2C1)C(=O)O
3-aminoisoquinoline-5-carboxylic acid; CAS No.: 1337880-90-6; 3-aminoisoquinoline-5-carboxylic acid. PROPERTIES: 3-aminoisoquinoline-5-carboxylic acid appears as a pale yellow solid with molecular formula C9H6N2O2. It has a melting point in the range of 220-225 C and shows moderate solubility in hot ethanol and DMSO. Proper storage involves maintaining in a sealed container at room temperature away from acidic vapors. Safety precautions include avoiding ingestion and using caution during handling as it may cause mild skin irritation. APPLICATIONS: This compound serves as a versatile intermediate in the synthesis of alkaloid mimetics. The amino and carboxylic acid groups provide dual functionality for creating macrocyclic structures as reported in natural products chemistry research. In pharmaceutical development, 3-aminoisoquinoline-5-carboxylic acid derivatives have shown potential as matrix metalloproteinase inhibitors. According to medicinal chemistry studies, the isoquinoline framework facilitates enzyme binding while the amino and carboxylic acid groups form critical interactions with the enzyme's active site.
Reviews
Write Your Own Review