4-fluoroisoquinoline-1-carboxylic acid
$300.00
CAS No.: 2225878-70-4
Catalog No.: 192183
Purity: 95%
MF: C10H6FNO2
MW: 191.161
Storage: 2-8 degree Celsius
SMILES: FC1=CN=C(C2=CC=CC=C12)C(=O)O
Catalog No.: 192183
Purity: 95%
MF: C10H6FNO2
MW: 191.161
Storage: 2-8 degree Celsius
SMILES: FC1=CN=C(C2=CC=CC=C12)C(=O)O
4-fluoroisoquinoline-1-carboxylic acid; CAS No.: 2225878-70-4; 4-fluoroisoquinoline-1-carboxylic acid. PROPERTIES: 4-fluoroisoquinoline-1-carboxylic acid is a crystalline solid with molecular formula C9H5FN2O2. It exhibits weak acidity typical of carboxylic acids and has a melting point ranging between 185-190 C. The compound is sparingly soluble in water but demonstrates better solubility in organic solvents like DMSO and DMF. Proper storage requires a tightly sealed container in a cool, dry place preferably below 20 C to prevent degradation. Safety precautions include wearing protective gloves, eye protection, and avoiding inhalation of dust as it may cause respiratory irritation. APPLICATIONS: This compound serves as a valuable intermediate in pharmaceutical synthesis. Its unique fluorinated isoquinoline structure makes it particularly useful in developing antimicrobial agents where the fluorine substituent enhances bioavailability. In medicinal chemistry research, 4-fluoroisoquinoline-1-carboxylic acid acts as a building block for creating more complex molecules targeting specific biological pathways. According to medicinal chemistry journals, the carboxylic acid group allows for further functionalization, enabling the creation of libraries of compounds for high-throughput screening against various disease targets.
Reviews
Write Your Own Review