1-oxo-1,2,3,4-tetrahydroisoquinoline-7-carboxylic acid
$300.00
CAS No.: 1343932-64-8
Catalog No.: 192730
Purity: 95%
MF: C10H9NO3
MW: 191.186
Storage: 2-8 degree Celsius
SMILES: O=C1NCCC2=CC=C(C=C12)C(=O)O
Catalog No.: 192730
Purity: 95%
MF: C10H9NO3
MW: 191.186
Storage: 2-8 degree Celsius
SMILES: O=C1NCCC2=CC=C(C=C12)C(=O)O
1-oxo-1,2,3,4-tetrahydroisoquinoline-7-carboxylic acid; CAS No.: 1343932-64-8; 1-oxo-1,2,3,4-tetrahydroisoquinoline-7-carboxylic acid. PROPERTIES: This oxo-substituted tetrahydroisoquinoline carboxylic acid has molecular formula C9H9N2O2. It generally appears as a white crystalline powder. The 1-oxo-1,2,3,4-tetrahydroisoquinoline-7-carboxylic acid demonstrates limited water solubility but good solubility in DMSO and DMF. Its melting point ranges between 180-185 C, and it has a molecular weight of approximately 181.18 g/mol. When handling, care should be taken to avoid skin contact and use of proper respiratory protection. Storage should be in a tightly sealed container at room temperature, protected from light and moisture. The compound is sensitive to strong acids and may decarboxylate upon exposure to high temperatures above 200 C. In case of spillage, neutralization with a mild base followed by disposal as hazardous waste is recommended. APPLICATIONS: The 1-oxo-1,2,3,4-tetrahydroisoquinoline-7-carboxylic acid functions as a key intermediate in the synthesis of serotonin receptor antagonists for psychiatric disorders where the oxo group provides essential hydrogen bonding interactions with receptor subtypes (as detailed in medicinal chemistry literature). The carboxylic acid group forms ionic interactions with receptor residues. Additionally, the compound serves as a building block in the preparation of fluorescent dyes for bioimaging applications with excitation maxima around 360 nm and emission maxima around 430 nm, as described in bioanalytical chemistry journals. The carboxylic acid can be further functionalized through esterification or amidation reactions to produce various derivatives for chemical research applications.
Reviews
Write Your Own Review