(S)-2-amino-3-(1-(tert-butoxycarbonyl)-1H-indol-3-yl)propanoic acid
$200.00
CAS No.: 146645-63-8
Catalog No.: 189191
Purity: 95%
MF: C16H20N2O4
MW: 304.346
Storage: 2-8 degree Celsius
SMILES: N[C@H](C(=O)O)CC1=CN(C2=CC=CC=C12)C(=O)OC(C)(C)C
Catalog No.: 189191
Purity: 95%
MF: C16H20N2O4
MW: 304.346
Storage: 2-8 degree Celsius
SMILES: N[C@H](C(=O)O)CC1=CN(C2=CC=CC=C12)C(=O)OC(C)(C)C
(S)-2-amino-3-(1-(tert-butoxycarbonyl)-1H-indol-3-yl)propanoic acid; CAS No.: 146645-63-8; (S)-2-amino-3-(1-(tert-butoxycarbonyl)-1H-indol-3-yl)propanoic acid exemplifies the protected amino acid building blocks category within Chem Shuttle's product offerings. As a chemical synthesis company, Chem Shuttle provides access to amino acid derivatives with Boc protection that are crucial for solid-phase peptide synthesis and other applications requiring temporary protection of amino groups. This compound, with its tert-butoxycarbonyl and indole substituents, is particularly valuable as a building block for the production of bioactive peptides and pharmaceuticals. Chem Shuttle's custom compound synthesis services allow for the production of such specialized amino acids to exact specifications, supporting the development of novel therapeutic agents. The company's focus on chemical blocks ensures that researchers can obtain high-purity (S)-2-amino-3-(1-(tert-butoxycarbonyl)-1H-indol-3-yl)propanoic acid, facilitating advancements in peptide chemistry and drug development.
Reviews
Write Your Own Review