methyl 1H-indole-4-carboxylate
$200.00
CAS No.: 39830-66-5
Catalog No.: 189150
Purity: 95%
MF: C10H9NO2
MW: 175.187
Storage: 2-8 degree Celsius
SMILES: N1C=CC=2C(=CC=CC12)C(=O)OC
Catalog No.: 189150
Purity: 95%
MF: C10H9NO2
MW: 175.187
Storage: 2-8 degree Celsius
SMILES: N1C=CC=2C(=CC=CC12)C(=O)OC
methyl 1H-indole-4-carboxylate; CAS No.: 39830-66-5; methyl 1H-indole-4-carboxylate exemplifies the indole carboxylates category within Chem Shuttle's product offerings. As a leading chemicals distributor, Chem Shuttle offers access to indole derivatives with ester functionality that are essential for the synthesis of various pharmaceuticals and agrochemicals. This compound, with its methyl ester and indole ring, is particularly valuable as a building block for the production of bioactive molecules with specific receptor affinities. Chem Shuttle's custom compound synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the development of novel therapeutic agents and materials. The company's focus on chemical blocks ensures that researchers can obtain high-purity methyl 1H-indole-4-carboxylate, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review