(1-(methoxycarbonyl)-1H-indol-2-yl)boronic acid
$300.00
CAS No.: 1001162-89-5
Catalog No.: 189353
Purity: 95%
MF: C10H10BNO4
MW: 219.005
Storage: 2-8 degree Celsius
SMILES: COC(=O)N1C(=CC2=CC=CC=C12)B(O)O
Catalog No.: 189353
Purity: 95%
MF: C10H10BNO4
MW: 219.005
Storage: 2-8 degree Celsius
SMILES: COC(=O)N1C(=CC2=CC=CC=C12)B(O)O
(1-(methoxycarbonyl)-1H-indol-2-yl)boronic acid; CAS No.: 1001162-89-5; (1-(methoxycarbonyl)-1H-indol-2-yl)boronic acid exemplifies the indoly boronic acids category within Chem Shuttle's product offerings. As a chemical synthesis company, Chem Shuttle provides access to heterocyclic boronic acid derivatives that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its indol and boronic acid groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that (1-(methoxycarbonyl)-1H-indol-2-yl)boronic acid is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review