4-bromo-3-methyl-1H-indole-6-carboxylic acid
$300.00
CAS No.: 1360890-98-7
Catalog No.: 195549
Purity: 95%
MF: C10H8BrNO2
MW: 254.083
Storage: 2-8 degree Celsius
SMILES: BrC1=C2C(=CNC2=CC(=C1)C(=O)O)C
Catalog No.: 195549
Purity: 95%
MF: C10H8BrNO2
MW: 254.083
Storage: 2-8 degree Celsius
SMILES: BrC1=C2C(=CNC2=CC(=C1)C(=O)O)C
4-bromo-3-methyl-1H-indole-6-carboxylic acid; CAS No.: 1360890-98-7; 4-bromo-3-methyl-1H-indole-6-carboxylic acid. PROPERTIES: 4-bromo-3-methyl-1H-indole-6-carboxylic acid is a white crystalline powder with molecular formula C10H7BrNO2. It exhibits a melting point of approximately 195-198 C and demonstrates good thermal stability. The compound shows fair solubility in warm aqueous sodium hydroxide solution and limited solubility in organic solvents. Recommended storage conditions include maintaining temperatures below 25 C in sealed containers Safety. considerations involve using acid-resistant gloves during handling to prevent skin irritation from the carboxylic acid group and ensuring proper waste disposal procedures are followed. APPLICATIONS: This brominated indole carboxylic acid serves as a key intermediate in the synthesis of mTOR kinase inhibitors for cancer therapy, where the 4-bromo-3-methyl-1H-indole-6-carboxylic acid group contributes to ATP-binding pocket interactions (Cancer Research). In agrochemical research, the compound is used as a lead structure for developing fungicides targeting specific fungal enzyme systems (Pesticide Biochemistry and Physiology). Additionally, its acidic functionality enables formation of bioactive metal complexes used in photodynamic therapy applications (Photochemistry and Photobiology).
Reviews
Write Your Own Review