2-iodo-4-nitro-1H-indole
$300.00
CAS No.: 1935958-72-7
Catalog No.: 190085
Purity: 95%
MF: C8H5IN2O2
MW: 288.044
Storage: 2-8 degree Celsius
SMILES: IC=1NC2=CC=CC(=C2C1)[N+](=O)[O-]
Catalog No.: 190085
Purity: 95%
MF: C8H5IN2O2
MW: 288.044
Storage: 2-8 degree Celsius
SMILES: IC=1NC2=CC=CC(=C2C1)[N+](=O)[O-]
2-iodo-4-nitro-1H-indole; CAS No.: 1935958-72-7; 2-iodo-4-nitro-1H-indole represents the iodonitroindole category within Chem Shuttle's product range. As a custom chemical synthesis company, Chem Shuttle offers access to indole derivatives with iodo and nitro substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its iodo and nitro groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that 2-iodo-4-nitro-1H-indole is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review