7-hydroxy-4-(trifluoromethyl)-2H-chromen-2-one
$300.00
CAS No.: 575-03-1
Catalog No.: 196237
Purity: 95%
MF: C10H5F3O3
MW: 230.141
Storage: 2-8 degree Celsius
SMILES: OC1=CC=C2C(=CC(OC2=C1)=O)C(F)(F)F
Catalog No.: 196237
Purity: 95%
MF: C10H5F3O3
MW: 230.141
Storage: 2-8 degree Celsius
SMILES: OC1=CC=C2C(=CC(OC2=C1)=O)C(F)(F)F
7-hydroxy-4-(trifluoromethyl)-2H-chromen-2-one; CAS No.: 575-03-1; 7-hydroxy-4-(trifluoromethyl)-2H-chromen-2-one. PROPERTIES: This compound features a 7-hydroxy-4-(trifluoromethyl)-2H-chromen-2-one structure, combining a hydroxyl group, a trifluoromethyl substituent, and a chromen-2-one framework. It typically appears as a white to off-white crystalline solid with a molecular weight of approximately 243.1 g/mol (C10H5F3O3). The melting point ranges between 150-155 C, and it exhibits moderate solubility in common organic solvents like DMSO and DMF while being sparingly soluble in water. Proper storage requires a tightly sealed container in a cool, dry place. Safety considerations include wearing appropriate PPE. It is classified as a skin and eye irritant (GHS07) with the hazard statement H315-H319. APPLICATIONS: 7-Hydroxy-4-(trifluoromethyl)-2H-chromen-2-one serves as a versatile intermediate in pharmaceutical and chemical synthesis. Its 7-hydroxy-4-(trifluoromethyl)-2H-chromen-2-one structure enables diverse reactivity patterns, including nucleophilic substitution at the hydroxyl group and electrophilic substitution at the chromen-2-one ring. In medicinal chemistry, it is used to develop bioactive molecules targeting the central nervous system and inflammatory pathways. The trifluoromethyl group provides metabolic stability and favorable binding interactions with biological targets. This compound also functions as a building block in the synthesis of fluorescent dyes and bioconjugation reagents. Academic studies employ it as a model compound in Organic Chemistry journals, focusing on the development of novel hydroxytrifluoromethylchromen derivatives based on the 7-hydroxy-4-(trifluoromethyl)-2H-chromen-2-one scaffold.
Reviews
Write Your Own Review