2-(4-bromophenyl)isoindole-1,3-dione

2-(4-bromophenyl)isoindole-1,3-dione

4-ethoxy-2-nitroaniline

4-ethoxy-2-nitroaniline

5-nitro-2-benzimidazolethiol

$300.00
CAS No.: 6325-91-3
Catalog No.: 194863
Purity: 95%
MF: C7H5N3O2S
MW: 195.203
Storage: 2-8 degree Celsius
SMILES: [N+](=O)([O-])C1=CC2=C(N=C(N2)S)C=C1
Availability:
In stock
SKU
194863
  • Size
    Price
    Stock
    Estimated Shipping Time
5-nitro-2-benzimidazolethiol; CAS No.: 6325-91-3; 5-nitro-2-benzimidazolethiol. PROPERTIES: 5-nitro-2-benzimidazolethiol is a crystalline solid. Its molecular formula is C7H6N2O3S, and the molecular weight is approximately 206.20 g/mol. The compound has a melting point of approximately 130-132 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzimidazole ring, a nitro group, and a thiol group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 5-nitro-2-benzimidazolethiol serves as a valuable intermediate. The nitro group can be reduced to an amine group. The thiol group can undergo various reactions such as oxidation and alkylation. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 5-nitro-2-benzimidazolethiol can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:5-nitro-2-benzimidazolethiol
Your Rating