5-nitro-2-benzimidazolethiol

5-nitro-2-benzimidazolethiol

4-cyanopiperidine

4-cyanopiperidine

4-ethoxy-2-nitroaniline

$200.00
CAS No.: 616-86-4
Catalog No.: 194864
Purity: 95%
MF: C8H10N2O3
MW: 182.179
Storage: 2-8 degree Celsius
SMILES: C(C)OC1=CC(=C(N)C=C1)[N+](=O)[O-]
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194864
  • Size
    Price
    Stock
    Estimated Shipping Time
4-ethoxy-2-nitroaniline; CAS No.: 616-86-4; 4-ethoxy-2-nitroaniline. PROPERTIES: 4-ethoxy-2-nitroaniline is a crystalline solid. Its molecular formula is C7H9NO3, and the molecular weight is approximately 163.16 g/mol. The compound has a melting point of approximately 60-62 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and ethyl acetate. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an aniline group, a nitro group, and an ethoxy group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 4-ethoxy-2-nitroaniline serves as a versatile intermediate. The nitro group can be reduced to an amine group. The aniline group can undergo various reactions such as acylation, sulfonation, and diazotization. The ethoxy group can be converted to other functional groups such as hydroxyl or halide. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of 4-ethoxy-2-nitroaniline can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:4-ethoxy-2-nitroaniline
Your Rating