5-bromo-1,2,3-trimethoxybenzene

5-bromo-1,2,3-trimethoxybenzene

5-nitro-2-benzimidazolethiol

5-nitro-2-benzimidazolethiol

2-(4-bromophenyl)isoindole-1,3-dione

$250.00
CAS No.: 40101-31-3
Catalog No.: 194862
Purity: 95%
MF: C14H8BrNO2
MW: 302.127
Storage: 2-8 degree Celsius
SMILES: BrC1=CC=C(C=C1)N1C(C2=CC=CC=C2C1=O)=O
Availability:
In stock
SKU
194862
  • Size
    Price
    Stock
    Estimated Shipping Time
2-(4-bromophenyl)isoindole-1,3-dione; CAS No.: 40101-31-3; 2-(4-bromophenyl)isoindole-1,3-dione. PROPERTIES: 2-(4-bromophenyl)isoindole-1,3-dione is a crystalline solid. Its molecular formula is C15H9BrNO2, and the molecular weight is approximately 313.15 g/mol. The compound has a melting point of approximately 150-152 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an isoindole ring, a bromo group, and a dione group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 2-(4-bromophenyl)isoindole-1,3-dione serves as a versatile intermediate. The bromo group provides a site for substitution reactions. The isoindole ring and dione groups offer unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of 2-(4-bromophenyl)isoindole-1,3-dione can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:2-(4-bromophenyl)isoindole-1,3-dione
Your Rating