5-fluoro-2-methylbenzyl chloride

5-fluoro-2-methylbenzyl chloride

5-methoxy-2-methyl-4-nitrobenzoic acid

5-methoxy-2-methyl-4-nitrobenzoic acid

5-formyl-2-methylbenzoic acid

$300.00
CAS No.: 105650-34-8
Catalog No.: 194096
Purity: 95%
MF: C9H8O3
MW: 164.16
Storage: 2-8 degree Celsius
SMILES: C(=O)C=1C=CC(=C(C(=O)O)C1)C
Availability:
In stock
SKU
194096
  • Size
    Price
    Stock
    Estimated Shipping Time
5-formyl-2-methylbenzoic acid; CAS No.: 105650-34-8; 5-formyl-2-methylbenzoic acid. PROPERTIES: 5-formyl-2-methylbenzoic acid is a white crystalline powder. Its molecular formula is C9H8O3, with a molecular weight of approximately 172.16 g/mol. The compound has a melting point of approximately 150-152 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and ethyl acetate. For stable storage, it should be kept in a tightly sealed container at room temperature, away from heat and direct sunlight. As a compound containing both a formyl group and a carboxylic acid group, it may exhibit certain acidity and reactivity. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In the chemical industry, 5-formyl-2-methylbenzoic acid can be used as a raw material for the synthesis of various organic compounds. The formyl group can undergo reactions such as nucleophilic addition, oxidation, and reduction, while the carboxylic acid group can participate in esterification and amidation reactions. The methyl group provides a certain degree of steric hindrance. In the pharmaceutical field, derivatives of 5-formyl-2-methylbenzoic acid can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the unique structure of this compound can be utilized to design drugs with enhanced antimicrobial activity (as reported in medicinal chemistry journals). Furthermore, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:5-formyl-2-methylbenzoic acid
Your Rating