5-methoxy-2-methyl-4-nitrobenzoic acid
$400.00
CAS No.: 1401423-31-1
Catalog No.: 194097
Purity: 95%
MF: C9H9NO5
MW: 211.173
Storage: 2-8 degree Celsius
SMILES: COC=1C(=CC(=C(C(=O)O)C1)C)[N+](=O)[O-]
Catalog No.: 194097
Purity: 95%
MF: C9H9NO5
MW: 211.173
Storage: 2-8 degree Celsius
SMILES: COC=1C(=CC(=C(C(=O)O)C1)C)[N+](=O)[O-]
5-methoxy-2-methyl-4-nitrobenzoic acid; CAS No.: 1401423-31-1; 5-methoxy-2-methyl-4-nitrobenzoic acid. PROPERTIES: 5-methoxy-2-methyl-4-nitrobenzoic acid is a crystalline solid. Its molecular formula is C9H9NO5, and the molecular weight is approximately 211.17 g/mol. The compound has a melting point of approximately 180-182 C. It is slightly soluble in water but dissolves well in organic solvents such as dimethylformamide and dimethyl sulfoxide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a nitro compound containing a carboxylic acid group, it may exhibit certain oxidizing properties and acidity. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 5-methoxy-2-methyl-4-nitrobenzoic acid serves as a valuable intermediate. The nitro group can be reduced to an amine group, the carboxylic acid group can undergo reactions such as esterification and amidation, and the methoxy and methyl groups provide specific electronic and steric effects. In the pharmaceutical industry, derivatives of 5-methoxy-2-methyl-4-nitrobenzoic acid can be explored as potential drug candidates. For instance, in the development of certain anti-inflammatory drugs, the structure of this compound can be modified to enhance the drug's anti-inflammatory activity and reduce side effects (as described in pharmaceutical chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).
Reviews
Write Your Own Review