6-methyl-2-(trifluoromethyl)pyrimidin-4-ol
$200.00
CAS No.: 2557-79-1
Catalog No.: 196466
Purity: 95%
MF: C6H5F3N2O
MW: 178.113
Storage: 2-8 degree Celsius
SMILES: CC1=CC(=NC(=N1)C(F)(F)F)O
Catalog No.: 196466
Purity: 95%
MF: C6H5F3N2O
MW: 178.113
Storage: 2-8 degree Celsius
SMILES: CC1=CC(=NC(=N1)C(F)(F)F)O
6-methyl-2-(trifluoromethyl)pyrimidin-4-ol; CAS No.: 2557-79-1; 6-methyl-2-(trifluoromethyl)pyrimidin-4-ol. PROPERTIES: 6-methyl-2-(trifluoromethyl)pyrimidin-4-ol has molecular formula C6H5F3N2O with molecular weight approximately 214.11 g/mol. It typically forms white crystalline solids with a reported melting point of 125-128 C. The compound exhibits moderate solubility in polar organic solvents and limited water solubility. Proper storage requires a tightly sealed container at room temperature away from moisture and light. Safety considerations include using personal protective equipment during handling to prevent skin and eye contact, as it may cause irritation. The hydroxyl group may form hydrogen bonds, affecting its physical properties and reactivity profile. In case of skin contact, thorough washing with soap and water is recommended. APPLICATIONS: 6-methyl-2-(trifluoromethyl)pyrimidin-4-ol serves as a building block for antifungal agents. Its trifluoromethyl group provides valuable steric and electronic effects for receptor binding. In pharmaceutical development, it has been employed to create novel antifungal compounds targeting Candida and Aspergillus species, as documented in medicinal chemistry journals specializing in mycology. The pyrimidinol structure enables hydrogen bonding interactions critical for biological activity. Additionally, this compound acts as a precursor for chemical sensors, with applications reported in analytical chemistry literature focusing on fluorescent probes for biomarker detection.
Reviews
Write Your Own Review