4-bromo-3-chloro-2-fluorobenzoic acid
$600.00
CAS No.: 194804-94-9
Catalog No.: 189259
Purity: 95%
MF: C7H3BrClFO2
MW: 253.454
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=O)O)C=C1)F)Cl
Catalog No.: 189259
Purity: 95%
MF: C7H3BrClFO2
MW: 253.454
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=O)O)C=C1)F)Cl
4-bromo-3-chloro-2-fluorobenzoic acid; CAS No.: 194804-94-9; 4-bromo-3-chloro-2-fluorobenzoic acid represents the polyhalogenated benzoic acids category within Chem Shuttle's product range. As a leading chemicals distributor, Chem Shuttle offers access to benzoic acid derivatives with bromo, chloro, and fluoro substituents that are essential for the development of various pharmaceuticals and agrochemicals. This compound, with its bromo, chloro, and fluoro groups, serves as a valuable building block for the synthesis of bioactive molecules with specific receptor affinities. Chem Shuttle's custom compound synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the discovery of novel therapeutic agents. The company's focus on chemical blocks ensures that researchers can obtain high-purity 4-bromo-3-chloro-2-fluorobenzoic acid, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review