5-bromo-1,2,3-trimethoxybenzene

5-bromo-1,2,3-trimethoxybenzene

3-(((benzylthio)carbonothioyl)thio)propanoic acid

3-(((benzylthio)carbonothioyl)thio)propanoic acid

5-acetyl-2-bromobenzaldehyde

$350.00
CAS No.: 2383820-38-8
Catalog No.: 194813
Purity: 95%
MF: C9H7BrO2
MW: 227.057
Storage: 2-8 degree Celsius
SMILES: C(C)(=O)C=1C=CC(=C(C=O)C1)Br
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194813
  • Size
    Price
    Stock
    Estimated Shipping Time
5-acetyl-2-bromobenzaldehyde; CAS No.: 2383820-38-8; 5-acetyl-2-bromobenzaldehyde. PROPERTIES: 5-acetyl-2-bromobenzaldehyde is a crystalline solid. Its molecular formula is C9H8BrO2, and the molecular weight is approximately 236.07 g/mol. The compound has a melting point of approximately 50-52 C. It is moderately soluble in common organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzene ring, an acetyl group, a bromine atom, and an aldehyde group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 5-acetyl-2-bromobenzaldehyde serves as a valuable intermediate. The aldehyde group can undergo various reactions such as nucleophilic addition, oxidation, and condensation. The bromine atom provides a site for substitution reactions. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of 5-acetyl-2-bromobenzaldehyde can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:5-acetyl-2-bromobenzaldehyde
Your Rating