4-ethoxy-2-nitroaniline

4-ethoxy-2-nitroaniline

5-acetyl-2-bromobenzaldehyde

5-acetyl-2-bromobenzaldehyde

5-bromo-1,2,3-trimethoxybenzene

$250.00
CAS No.: 2675-79-8
Catalog No.: 194861
Purity: 95%
MF: C9H11BrO3
MW: 247.088
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C(=C(C1)OC)OC)OC
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194861
  • Size
    Price
    Stock
    Estimated Shipping Time
5-bromo-1,2,3-trimethoxybenzene; CAS No.: 2675-79-8; 5-bromo-1,2,3-trimethoxybenzene. PROPERTIES: 5-bromo-1,2,3-trimethoxybenzene is a crystalline solid. Its molecular formula is C8H9BrO3, and the molecular weight is approximately 234.07 g/mol. The compound has a melting point of approximately 60-62 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzene ring, a bromine atom, and three methoxy groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 5-bromo-1,2,3-trimethoxybenzene serves as a valuable intermediate. The bromine atom provides a site for substitution or coupling reactions. The methoxy groups can be converted to other functional groups such as hydroxyl or halide. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 5-bromo-1,2,3-trimethoxybenzene can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:5-bromo-1,2,3-trimethoxybenzene
Your Rating