3-(((benzylthio)carbonothioyl)thio)propanoic acid
$400.00
CAS No.: 497931-76-7
Catalog No.: 194780
Purity: 95%
MF: C11H12O2S3
MW: 272.416
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)SC(=S)SCCC(=O)O
Catalog No.: 194780
Purity: 95%
MF: C11H12O2S3
MW: 272.416
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)SC(=S)SCCC(=O)O
3-(((benzylthio)carbonothioyl)thio)propanoic acid; CAS No.: 497931-76-7; 3-(((benzylthio)carbonothioyl)thio)propanoic acid. PROPERTIES: 3-(((benzylthio)carbonothioyl)thio)propanoic acid is a crystalline solid. Its molecular formula is C11H11O3S3, and the molecular weight is approximately 283.35 g/mol. The compound has a melting point of approximately 80-82 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a propanoic acid group, a benzylthio group, and a carbonothioyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 3-(((benzylthio)carbonothioyl)thio)propanoic acid serves as a versatile intermediate. The carboxylic acid group can undergo reactions such as esterification and amidation. The benzylthio and carbonothioyl groups provide opportunities for further functionalization. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 3-(((benzylthio)carbonothioyl)thio)propanoic acid can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).
Reviews
Write Your Own Review