methyl 7-bromo-3-hydroxy-2-naphthoate

methyl 7-bromo-3-hydroxy-2-naphthoate

1,8-diiodonaphthalene

1,8-diiodonaphthalene

4-hydroxy-5-((2-hydroxybenzylidene)amino)naphthalene-2,7-disulfonic acid

$300.00
CAS No.: 32266-60-7
Catalog No.: 194907
Purity: 95%
MF: C17H13NO8S2
MW: 423.424
Storage: 2-8 degree Celsius
SMILES: OC1=CC(=CC2=CC(=CC(=C12)N=CC1=C(C=CC=C1)O)S(=O)(=O)O)S(=O)(=O)O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194907
  • Size
    Price
    Stock
    Estimated Shipping Time
4-hydroxy-5-((2-hydroxybenzylidene)amino)naphthalene-2,7-disulfonic acid; CAS No.: 32266-60-7; 4-hydroxy-5-((2-hydroxybenzylidene)amino)naphthalene-2,7-disulfonic acid. PROPERTIES: 4-hydroxy-5-((2-hydroxybenzylidene)amino)naphthalene-2,7-disulfonic acid is a crystalline solid. Its molecular formula is C16H12N2Na2O8S2, and the molecular weight is approximately 512.42 g/mol. The compound has a melting point of approximately 180-182 C. It is moderately soluble in water and commonly used in the form of its disodium salt. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a naphthalene ring, hydroxyl groups, an amino group, and sulfonic acid groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, this compound serves as a specialized intermediate. The sulfonic acid groups can undergo various reactions such as esterification and alkylation. The hydroxyl groups and amino group provide additional sites for functionalization. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antioxidants, the structure of 4-hydroxy-5-((2-hydroxybenzylidene)amino)naphthalene-2,7-disulfonic acid can be modified to enhance its antioxidant activity and bioavailability (as noted in medicinal chemistry research papers). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:4-hydroxy-5-((2-hydroxybenzylidene)amino)naphthalene-2,7-disulfonic acid
Your Rating