methyl 7-bromo-3-hydroxy-2-naphthoate
$300.00
CAS No.: 10155-36-9
Catalog No.: 194163
Purity: 95%
MF: C12H9BrO3
MW: 281.105
Storage: 2-8 degree Celsius
SMILES: BrC1=CC=C2C=C(C(=CC2=C1)C(=O)OC)O
Catalog No.: 194163
Purity: 95%
MF: C12H9BrO3
MW: 281.105
Storage: 2-8 degree Celsius
SMILES: BrC1=CC=C2C=C(C(=CC2=C1)C(=O)OC)O
methyl 7-bromo-3-hydroxy-2-naphthoate; CAS No.: 10155-36-9; methyl 7-bromo-3-hydroxy-2-naphthoate. PROPERTIES: methyl 7-bromo-3-hydroxy-2-naphthoate is a crystalline solid. Its molecular formula is C12H9BrO3, and the molecular weight is approximately 277.06 g/mol. The compound has a melting point of approximately 100-102 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a brominated aromatic compound containing a hydroxyl group and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, methyl 7-bromo-3-hydroxy-2-naphthoate serves as a valuable intermediate. The bromine atom provides a site for substitution or coupling reactions, the hydroxyl group can be converted to other functional groups such as ether or ester, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of methyl 7-bromo-3-hydroxy-2-naphthoate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can influence the material's properties (as mentioned in materials chemistry research papers).
Reviews
Write Your Own Review