4-chloro-2-methoxy-1-nitrobenzene
$250.00
CAS No.: 6627-53-8
Catalog No.: 189193
Purity: 95%
MF: C7H6ClNO3
MW: 187.582
Storage: 2-8 degree Celsius
SMILES: ClC1=CC(=C(C=C1)[N+](=O)[O-])OC
Catalog No.: 189193
Purity: 95%
MF: C7H6ClNO3
MW: 187.582
Storage: 2-8 degree Celsius
SMILES: ClC1=CC(=C(C=C1)[N+](=O)[O-])OC
4-chloro-2-methoxy-1-nitrobenzene; CAS No.: 6627-53-8; 4-chloro-2-methoxy-1-nitrobenzene represents the chloromethoxynitrobenzenes category within Chem Shuttle's product range. As a custom chemical synthesis company, Chem Shuttle specializes in producing aromatic compounds with chloro, methoxy, and nitro substituents that serve as key intermediates in drug development and materials science. This compound, with its chloro, methoxy, and nitro groups, is particularly valuable as a building block for the synthesis of various pharmaceuticals and agrochemicals requiring multiple functional groups. Chem Shuttle's online chemical mall provides researchers with convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that 4-chloro-2-methoxy-1-nitrobenzene is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review