![(3aS,4S,6R,6aR)-6-(6-amino-2-chloro-9H-purin-9-yl)-N-ethyl-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxole-4-carboxamide](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/0/100686_1.jpg)
Pemigatinib
$450.00
CAS No.: 1513857-77-6
Catalog No.: ZB2120
Purity: 95%
MF: C24H27F2N5O4
MW: 487.507
Storage: 2-8 degree Celsius
SMILES: FC1=C(C(=C(C=C1OC)OC)F)N1C(N(C2=C(C1)C=NC1=C2C=C(N1)CN1CCOCC1)CC)=O
Catalog No.: ZB2120
Purity: 95%
MF: C24H27F2N5O4
MW: 487.507
Storage: 2-8 degree Celsius
SMILES: FC1=C(C(=C(C=C1OC)OC)F)N1C(N(C2=C(C1)C=NC1=C2C=C(N1)CN1CCOCC1)CC)=O
CAS NO.:1513857-77-6; Pemigatinib is part of ChemShuttle's array of heterocycles and various organic chemicals, offered via their custom chemical synthesis services. As a chemical synthesis company, ChemShuttle focuses on Small molecules synthesis, including Pemigatinib (CAS No. 1513857-77-6). Their tailored synthesis approach ensures Pemigatinib meets specific research requirements, serving as a key intermediate in drug discovery. ChemShuttle's process chemistry capabilities optimize Pemigatinib (CAS No. 1513857-77-6) production, while their full-time equivalent model refines synthesis processes. Researchers profit from ChemShuttle's custom synthesis expertise, positioning Pemigatinib as a vital pharma building block within their chemical blocks selection.
Reviews
Write Your Own Review