5-bromo-2-methoxybenzenesulfonyl chloride
$200.00
CAS No.: 23095-05-8
Catalog No.: 189250
Purity: 95%
MF: C7H6BrClO3S
MW: 285.546
Storage: 2-8 degree Celsius
SMILES: BrC=1C=CC(=C(C1)S(=O)(=O)Cl)OC
Catalog No.: 189250
Purity: 95%
MF: C7H6BrClO3S
MW: 285.546
Storage: 2-8 degree Celsius
SMILES: BrC=1C=CC(=C(C1)S(=O)(=O)Cl)OC
5-bromo-2-methoxybenzenesulfonyl chloride; CAS No.: 23095-05-8; 5-bromo-2-methoxybenzenesulfonyl chloride belongs to Chem Shuttle's collection of brominated sulfonyl chlorides that serve as key intermediates in organic synthesis. As a leading chemicals distributor, Chem Shuttle offers access to benzenesulfonyl chloride derivatives with bromo and methoxy substituents that are essential for the development of various pharmaceuticals and agrochemicals. This compound, with its bromo and methoxy groups, is particularly valuable as a building block for the production of bioactive molecules with specific sulfonamide functionalities. Chem Shuttle's custom compound synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the discovery of novel therapeutic agents. The company's focus on chemical blocks ensures that researchers can obtain high-purity 5-bromo-2-methoxybenzenesulfonyl chloride, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review