4-bromo-3,5-difluorotoluene

4-bromo-3,5-difluorotoluene

4-chloro-2-(trifluoromethyl)benzyl amine

4-chloro-2-(trifluoromethyl)benzyl amine

4-bromo-3-fluoro-2-methylbenzoic acid

$350.00
CAS No.: 1349716-97-7
Catalog No.: 194046
Purity: 95%
MF: C8H6BrFO2
MW: 233.036
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=O)O)C=C1)C)F
For R&D use only. Not for human or veterinary use.
Availability:
In stock
SKU
194046
  • Size
    Price
    Stock
    Estimated Shipping Time
4-bromo-3-fluoro-2-methylbenzoic acid; CAS No.: 1349716-97-7; 4-bromo-3-fluoro-2-methylbenzoic acid. PROPERTIES: 4-bromo-3-fluoro-2-methylbenzoic acid is a crystalline solid with a molecular weight of 243.0 g/mol. It typically exhibits a melting point in the range of 132-135 C and limited water solubility, though it dissolves readily in organic solvents such as methanol, ethanol, and dichloromethane. The compound contains reactive functional groups including a carboxylic acid group, bromine substituent, fluorine substituent, and a methyl group, which contribute to its chemical versatility. For optimal storage, it should be kept in a tightly sealed container at temperatures below 20 C, preferably under inert atmosphere to prevent potential degradation. Safety considerations include wearing appropriate protective clothing, gloves, and eye/face protection to minimize exposure risk. The compound may cause eye irritation and skin irritation, and in case of accidental ingestion, immediate medical attention is advised. APPLICATIONS: 4-bromo-3-fluoro-2-methylbenzoic acid serves as a valuable intermediate in the synthesis of various pharmaceuticals, particularly in the development of anti-inflammatory and analgesic agents. Its unique substitution pattern allows for selective derivatization, making it suitable for constructing bioactive scaffolds, as reported in medicinal chemistry literature. In materials science, the compound functions as a building block for certain types of liquid crystalline materials, where the electron-donating methyl group and electron-withdrawing bromine and fluorine substituents create a balanced electronic environment. Additionally, it is utilized in the preparation of specialty dyes and pigments, particularly those requiring specific optical properties. Through chemical modification of the carboxylic acid group, it can be converted into various esters, amides, or acid chlorides, expanding its application scope in organic synthesis. The bromine substituent provides a convenient handle for further functionalization, such as in cross-coupling reactions.

Reviews

Write Your Own Review
You're reviewing:4-bromo-3-fluoro-2-methylbenzoic acid
Your Rating