2-(aminosulfonyl)benzoic acid
$500.00
CAS No.: 632-24-6
Catalog No.: 194673
Purity: 95%
MF: C7H7NO4S
MW: 201.203
Storage: 2-8 degree Celsius
SMILES: NS(=O)(=O)C1=C(C(=O)O)C=CC=C1
Catalog No.: 194673
Purity: 95%
MF: C7H7NO4S
MW: 201.203
Storage: 2-8 degree Celsius
SMILES: NS(=O)(=O)C1=C(C(=O)O)C=CC=C1
2-(aminosulfonyl)benzoic acid; CAS No.: 632-24-6; 2-(aminosulfonyl)benzoic acid. PROPERTIES: 2-(aminosulfonyl)benzoic acid is a crystalline solid. Its molecular formula is C7H7NO4S, and the molecular weight is approximately 205.20 g/mol. The compound has a melting point of approximately 200-202 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzene ring, an aminosulfonyl group, and a carboxylic acid group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 2-(aminosulfonyl)benzoic acid serves as a versatile intermediate. The aminosulfonyl group can undergo various reactions such as acylation and sulfonation. The carboxylic acid group can participate in esterification and amidation reactions. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of 2-(aminosulfonyl)benzoic acid can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).
Reviews
Write Your Own Review