2-(trifluoromethyl)quinoline-7-carboxylic acid
$500.00
CAS No.: 868662-63-9
Catalog No.: 192207
Purity: 95%
MF: C11H6F3NO2
MW: 241.168
Storage: 2-8 degree Celsius
SMILES: FC(C1=NC2=CC(=CC=C2C=C1)C(=O)O)(F)F
Catalog No.: 192207
Purity: 95%
MF: C11H6F3NO2
MW: 241.168
Storage: 2-8 degree Celsius
SMILES: FC(C1=NC2=CC(=CC=C2C=C1)C(=O)O)(F)F
2-(trifluoromethyl)quinoline-7-carboxylic acid; CAS No.: 868662-63-9; 2-(trifluoromethyl)quinoline-7-carboxylic acid. PROPERTIES: 2-(trifluoromethyl)quinoline-7-carboxylic acid is a crystalline substance with molecular weight 223.15 g/mol. It has a melting point between 210-215 C and shows limited solubility in water but dissolves in hot acetic acid. The compound is light-sensitive and should be stored in amber containers at 2-8 C. Safety considerations include using respiratory protection during handling due to its potential to cause respiratory tract irritation, along with standard lab PPE. APPLICATIONS: This compound is utilized in the synthesis of HIV integrase inhibitors where the trifluoromethyl group enhances enzyme binding affinity as described in antiviral research papers. The carboxylic acid functionality allows for amide bond formation, making it suitable for creating peptide mimetics. Additionally, 2-(trifluoromethyl)quinoline-7-carboxylic acid derivatives have found use in bioanalytical chemistry as fluorescent probes for detecting specific metal ions. According to analytical chemistry journals, the quinoline scaffold provides a fluorescent response upon metal coordination, enabling sensitive detection methods.
Reviews
Write Your Own Review